CH628083A5 - Bei sauerstoffausschluss erhaertende klebstoffe oder dichtungsmittel. - Google Patents
Bei sauerstoffausschluss erhaertende klebstoffe oder dichtungsmittel. Download PDFInfo
- Publication number
- CH628083A5 CH628083A5 CH240077A CH240077A CH628083A5 CH 628083 A5 CH628083 A5 CH 628083A5 CH 240077 A CH240077 A CH 240077A CH 240077 A CH240077 A CH 240077A CH 628083 A5 CH628083 A5 CH 628083A5
- Authority
- CH
- Switzerland
- Prior art keywords
- adhesives
- sealants
- oxygen
- exclusion
- acrylic acid
- Prior art date
Links
- 239000000853 adhesive Substances 0.000 title claims description 32
- 239000000565 sealant Substances 0.000 title claims description 16
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 title claims description 8
- 239000001301 oxygen Substances 0.000 title claims description 8
- 229910052760 oxygen Inorganic materials 0.000 title claims description 8
- 230000001070 adhesive effect Effects 0.000 claims description 31
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 claims description 22
- 150000002148 esters Chemical class 0.000 claims description 22
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 12
- 239000000203 mixture Substances 0.000 claims description 9
- 239000007795 chemical reaction product Substances 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 6
- -1 OH groups (meth) acrylic acid esters Chemical class 0.000 claims description 5
- 150000001991 dicarboxylic acids Chemical class 0.000 claims description 3
- 150000002432 hydroperoxides Chemical class 0.000 claims description 3
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims description 2
- 125000005397 methacrylic acid ester group Chemical group 0.000 claims description 2
- 230000007717 exclusion Effects 0.000 claims 5
- 150000001298 alcohols Chemical class 0.000 claims 2
- 125000005396 acrylic acid ester group Chemical group 0.000 claims 1
- 125000001931 aliphatic group Chemical group 0.000 claims 1
- 239000000470 constituent Substances 0.000 claims 1
- 125000003700 epoxy group Chemical group 0.000 claims 1
- 125000003055 glycidyl group Chemical group C(C1CO1)* 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 24
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 20
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 19
- 239000002253 acid Substances 0.000 description 18
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 16
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 16
- 238000012360 testing method Methods 0.000 description 14
- 229910000831 Steel Inorganic materials 0.000 description 10
- 229910052782 aluminium Inorganic materials 0.000 description 10
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 10
- 239000010959 steel Substances 0.000 description 10
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 9
- 229910052757 nitrogen Inorganic materials 0.000 description 9
- 238000005452 bending Methods 0.000 description 8
- VOZRXNHHFUQHIL-UHFFFAOYSA-N glycidyl methacrylate Chemical compound CC(=C)C(=O)OCC1CO1 VOZRXNHHFUQHIL-UHFFFAOYSA-N 0.000 description 8
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 8
- GYVGXEWAOAAJEU-UHFFFAOYSA-N n,n,4-trimethylaniline Chemical compound CN(C)C1=CC=C(C)C=C1 GYVGXEWAOAAJEU-UHFFFAOYSA-N 0.000 description 8
- 229920002818 (Hydroxyethyl)methacrylate Polymers 0.000 description 7
- ICGLPKIVTVWCFT-UHFFFAOYSA-N 4-methylbenzenesulfonohydrazide Chemical compound CC1=CC=C(S(=O)(=O)NN)C=C1 ICGLPKIVTVWCFT-UHFFFAOYSA-N 0.000 description 7
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical compound CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 description 7
- SMTUJUHULKBTBS-UHFFFAOYSA-N benzyl(trimethyl)azanium;methanolate Chemical compound [O-]C.C[N+](C)(C)CC1=CC=CC=C1 SMTUJUHULKBTBS-UHFFFAOYSA-N 0.000 description 7
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 6
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 6
- 239000003112 inhibitor Substances 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 150000002009 diols Chemical class 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- LCXXNKZQVOXMEH-UHFFFAOYSA-N Tetrahydrofurfuryl methacrylate Chemical compound CC(=C)C(=O)OCC1CCCO1 LCXXNKZQVOXMEH-UHFFFAOYSA-N 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 3
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000007789 sealing Methods 0.000 description 3
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- HHCHLHOEAKKCAB-UHFFFAOYSA-N 2-oxaspiro[3.5]nonane-1,3-dione Chemical compound O=C1OC(=O)C11CCCCC1 HHCHLHOEAKKCAB-UHFFFAOYSA-N 0.000 description 2
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 239000013466 adhesive and sealant Substances 0.000 description 2
- 238000004026 adhesive bonding Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 2
- 229940117969 neopentyl glycol Drugs 0.000 description 2
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 2
- NIDNOXCRFUCAKQ-UMRXKNAASA-N (1s,2r,3s,4r)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid Chemical compound C1[C@H]2C=C[C@@H]1[C@H](C(=O)O)[C@@H]2C(O)=O NIDNOXCRFUCAKQ-UMRXKNAASA-N 0.000 description 1
- JHPBZFOKBAGZBL-UHFFFAOYSA-N (3-hydroxy-2,2,4-trimethylpentyl) 2-methylprop-2-enoate Chemical compound CC(C)C(O)C(C)(C)COC(=O)C(C)=C JHPBZFOKBAGZBL-UHFFFAOYSA-N 0.000 description 1
- KMOUUZVZFBCRAM-OLQVQODUSA-N (3as,7ar)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione Chemical compound C1C=CC[C@@H]2C(=O)OC(=O)[C@@H]21 KMOUUZVZFBCRAM-OLQVQODUSA-N 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- VHSHLMUCYSAUQU-UHFFFAOYSA-N 2-hydroxypropyl methacrylate Chemical compound CC(O)COC(=O)C(C)=C VHSHLMUCYSAUQU-UHFFFAOYSA-N 0.000 description 1
- MEJAPGGFIJZHEJ-UHFFFAOYSA-N 5-acetamido-1,3,4-thiadiazole-2-sulfonyl chloride Chemical compound CC(=O)NC1=NN=C(S(Cl)(=O)=O)S1 MEJAPGGFIJZHEJ-UHFFFAOYSA-N 0.000 description 1
- 229910000838 Al alloy Inorganic materials 0.000 description 1
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000012790 adhesive layer Substances 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical group [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- UUZYBYIOAZTMGC-UHFFFAOYSA-M benzyl(trimethyl)azanium;bromide Chemical compound [Br-].C[N+](C)(C)CC1=CC=CC=C1 UUZYBYIOAZTMGC-UHFFFAOYSA-M 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- OIWOHHBRDFKZNC-UHFFFAOYSA-N cyclohexyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OC1CCCCC1 OIWOHHBRDFKZNC-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- KCAMXZBMXVIIQN-UHFFFAOYSA-N octan-3-yl 2-methylprop-2-enoate Chemical compound CCCCCC(CC)OC(=O)C(C)=C KCAMXZBMXVIIQN-UHFFFAOYSA-N 0.000 description 1
- 238000000053 physical method Methods 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 238000013001 point bending Methods 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000013112 stability test Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- 229940073455 tetraethylammonium hydroxide Drugs 0.000 description 1
- LRGJRHZIDJQFCL-UHFFFAOYSA-M tetraethylazanium;hydroxide Chemical compound [OH-].CC[N+](CC)(CC)CC LRGJRHZIDJQFCL-UHFFFAOYSA-M 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- HADKRTWCOYPCPH-UHFFFAOYSA-M trimethylphenylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C1=CC=CC=C1 HADKRTWCOYPCPH-UHFFFAOYSA-M 0.000 description 1
- 239000011345 viscous material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09J—ADHESIVES; NON-MECHANICAL ASPECTS OF ADHESIVE PROCESSES IN GENERAL; ADHESIVE PROCESSES NOT PROVIDED FOR ELSEWHERE; USE OF MATERIALS AS ADHESIVES
- C09J4/00—Adhesives based on organic non-macromolecular compounds having at least one polymerisable carbon-to-carbon unsaturated bond ; adhesives, based on monomers of macromolecular compounds of groups C09J183/00 - C09J183/16
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Adhesives Or Adhesive Processes (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Sealing Material Composition (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762607962 DE2607962A1 (de) | 1976-02-27 | 1976-02-27 | Bei sauerstoffausschluss erhaertende klebstoffe und dichtungsmassen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH628083A5 true CH628083A5 (de) | 1982-02-15 |
Family
ID=5971000
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH240077A CH628083A5 (de) | 1976-02-27 | 1977-02-25 | Bei sauerstoffausschluss erhaertende klebstoffe oder dichtungsmittel. |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4096323A (en]) |
| JP (1) | JPS52104551A (en]) |
| AT (1) | AT353380B (en]) |
| BE (1) | BE851826A (en]) |
| CH (1) | CH628083A5 (en]) |
| DE (1) | DE2607962A1 (en]) |
| FR (1) | FR2342328A1 (en]) |
| IT (1) | IT1075285B (en]) |
| NL (1) | NL7701099A (en]) |
| SE (1) | SE7701140L (en]) |
| ZA (1) | ZA771146B (en]) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3713348A1 (de) * | 1987-04-21 | 1988-11-10 | Basf Ag | Wasserloesliche copolymerisate, verfahren zu deren herstellung und verwendung |
| JP2001305733A (ja) * | 2000-04-18 | 2001-11-02 | Sumitomo Chem Co Ltd | 感光性組成物の保存方法 |
| US8546486B2 (en) * | 2007-09-18 | 2013-10-01 | Ccp Composites Us Llc | Low VOC thermosetting polyester acrylic resin for gel coat |
| US10968310B1 (en) * | 2015-04-28 | 2021-04-06 | Adhesive R&D, Inc. | Polymerizable materials, anaerobically curable compositions, and related methods and products |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3784525A (en) * | 1972-04-12 | 1974-01-08 | Ciba Geigy Corp | Long-chain diglycidyl esters |
| US3974128A (en) * | 1972-05-08 | 1976-08-10 | The Gillette Company | Esters of maleic anhydride interpolymers |
| JPS5224929B2 (en]) * | 1973-06-26 | 1977-07-05 | ||
| US3997627A (en) * | 1973-08-29 | 1976-12-14 | Mitsubishi Rayon Co., Ltd. | Polyester molding compositions containing hydroxy containing vinyl monomers and coated molded articles thereof |
| US3959405A (en) * | 1973-12-19 | 1976-05-25 | Ford Motor Company | Powder coating compositions comprising a blend of coreactive polymers - III |
| GB1464250A (en) * | 1973-12-27 | 1977-02-09 | Ciba Geigy Ag | Acrylate derivatives and their use as anaerobically-curing adhesives |
| GB1458121A (en) * | 1974-02-04 | 1976-12-08 | Shell Int Research | Epoxy resin composition |
| US3919345A (en) * | 1974-03-04 | 1975-11-11 | Ford Motor Co | Powdered coating composition containing polyanhydride, epoxy and anhydride functional copolymer and flow control agent |
| US4007322A (en) * | 1974-10-07 | 1977-02-08 | Accrabond Corporation | Acrylic anaerobic sealant compositions and method of bonding |
| US3843594A (en) * | 1974-12-17 | 1974-10-22 | Ford Motor Co | Thermoset molding powders employing glycidyl methacrylate-functional prepolymers and diphenol-expoxy resin adducts and molding thereof |
| US4007323A (en) * | 1975-10-28 | 1977-02-08 | Loctite Corporation | Initiator for anaerobic compositions |
-
1976
- 1976-02-27 DE DE19762607962 patent/DE2607962A1/de not_active Ceased
-
1977
- 1977-02-02 SE SE7701140A patent/SE7701140L/xx not_active Application Discontinuation
- 1977-02-02 NL NL7701099A patent/NL7701099A/xx not_active Application Discontinuation
- 1977-02-22 US US05/770,381 patent/US4096323A/en not_active Expired - Lifetime
- 1977-02-22 IT IT20549/77A patent/IT1075285B/it active
- 1977-02-24 JP JP1875677A patent/JPS52104551A/ja active Pending
- 1977-02-25 BE BE175256A patent/BE851826A/xx not_active IP Right Cessation
- 1977-02-25 FR FR7705508A patent/FR2342328A1/fr active Granted
- 1977-02-25 AT AT127677A patent/AT353380B/de not_active IP Right Cessation
- 1977-02-25 CH CH240077A patent/CH628083A5/de not_active IP Right Cessation
- 1977-02-25 ZA ZA00771146A patent/ZA771146B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE851826A (en]) | 1977-08-25 |
| JPS52104551A (en) | 1977-09-02 |
| US4096323A (en) | 1978-06-20 |
| SE7701140L (sv) | 1977-08-28 |
| ATA127677A (de) | 1979-04-15 |
| FR2342328A1 (fr) | 1977-09-23 |
| AT353380B (de) | 1979-11-12 |
| NL7701099A (nl) | 1977-08-30 |
| DE2607962A1 (de) | 1977-09-01 |
| IT1075285B (it) | 1985-04-22 |
| ZA771146B (en) | 1978-01-25 |
| FR2342328B1 (en]) | 1980-01-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3008258C2 (de) | Verfahren zur Herstellung einer anaerob härtenden chemischen Zusammensetzung | |
| EP0163858B1 (de) | Stabilisierte Klebstoffe | |
| US3041322A (en) | Anaerobic curing compositions containing acrylic acid diesters | |
| DE2337049C3 (de) | Verfahren zur Herstellung einer Klebstoffzusammensetzung auf Basis einer polymerisierbaren Verbindung und eines Polymerisationskatalysators | |
| DE1719144C3 (de) | Unter Sauerstoffausschluß beschleunigt erhärtende Klebstoffe oder Dichtungsmittel | |
| DE2714538C3 (de) | Methacrylsäureester von auf tricyclischen Decanolen aufgebauten Verbindungen | |
| DE2607959A1 (de) | Bei sauerstoffausschluss erhaertende klebstoffe und dichtungsmassen | |
| DE3012478C2 (de) | Verfahren zur Herstellung eines lagerbeständigen Klebstoffs | |
| CH628082A5 (de) | Bei sauerstoffausschluss erhaertende klebstoffe oder dichtungsmittel. | |
| DE2833842A1 (de) | Verbesserte klebstoffzubereitung auf basis von 2-cyanacrylaten und verfahren zur verbesserung der klebstoffeigenschaften derartiger zubereitungen | |
| EP0052800B1 (de) | Acrylsäureester bzw. Methacrylsäureester von OH-gruppenhaltigen Isocyanursäurederivaten, Verfahren zu deren Herstellung sowie deren Verwendung als Klebstoff | |
| CH628083A5 (de) | Bei sauerstoffausschluss erhaertende klebstoffe oder dichtungsmittel. | |
| EP0008110B1 (de) | Klebstoff bzw. Klebstoffkomponente und seine bzw. ihre Verwendung zum Verkleben von zwei Oberflächen | |
| DE2714537C2 (de) | Bei Sauerstoffausschluß erhärtende Klebstoffe und Dichtungsmassen | |
| CH643588A5 (de) | Zubereitung, die zusammen mit aldehyd/amin-kondensat als klebstoff wirksam ist. | |
| DE2607960A1 (de) | Bei sauerstoffausschluss erhaertende klebstoffe und dichtungsmassen | |
| DE2006630C3 (de) | Anaerob härtbare Polyesterpolyacrylat-Massen | |
| DE69202415T2 (de) | Strukturklebstoff auf der Basis von einem Acrylreagenz. | |
| GB2163439A (en) | Adhesive bonding | |
| EP0043448B1 (de) | Bis-methacrylsäureester des 2,5-Dimethylol-tetrahydrofurans, Verfahren zu ihrer Herstellung und diese enthaltende Klebstoffe, beziehungsweise Dichtungsmittel | |
| EP0641846A1 (de) | Durch radikalische Polymerisation aushärtende, geruchsarme (Meth-)acrylatzubereitungen und ihre Verwendung | |
| DE4437471A1 (de) | Beschichtungszusammensetzung | |
| DE2607955A1 (de) | Bei sauerstoffausschluss erhaertende klebstoffe und dichtungsmassen | |
| DE2402427C3 (de) | Anaerob härtende Masse | |
| DE2128983C3 (en]) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |